C25H23Cl2N5O4 — CID 176554010
[7-[(3-amino-2-chlorophenyl)-(pyrimidin-2-ylamino)methyl]-5-chloroquinolin-8-yl]oxymethyl propan-2-yl carbonate (PubChem CID 176554010) has the molecular formula C25H23Cl2N5O4 and a molecular weight of 528.40 g/mol. Its IUPAC name is [7-[(3-amino-2-chlorophenyl)-(pyrimidin-2-ylamino)methyl]-5-chloroquinolin-8-yl]oxymethyl propan-2-yl carbonate.
| Compound Name | [7-[(3-amino-2-chlorophenyl)-(pyrimidin-2-ylamino)methyl]-5-chloroquinolin-8-yl]oxymethyl propan-2-yl carbonate |
|---|---|
| PubChem CID | 176554010 |
| Molecular Formula | C25H23Cl2N5O4 |
| Molecular Weight | 528.40 g/mol |
| Exact Mass | 527.11 |
| IUPAC Name | [7-[(3-amino-2-chlorophenyl)-(pyrimidin-2-ylamino)methyl]-5-chloroquinolin-8-yl]oxymethyl propan-2-yl carbonate |
| SMILES | CC(C)OC(=O)OCOc1c(C(Nc2ncccn2)c2cccc(N)c2Cl)cc(Cl)c2cccnc12 |
| InChI | InChI=1S/C25H23Cl2N5O4/c1-14(2)36-25(33)35-13-34-23-17(12-18(26)15-7-4-9-29-22(15)23)21(32-24-30-10-5-11-31-24)16-6-3-8-19(28)20(16)27/h3-12,14,21H,13,28H2,1-2H3,(H,30,31,32) |
| InChIKey | YRMQFQHXWHAXNJ-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 121.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.40 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|