C17H13ClIN3O2 — CID 172655091
N-[2-amino-3-(5-chloro-7-iodoquinolin-8-yl)oxyphenyl]acetamide (PubChem CID 172655091) has the molecular formula C17H13ClIN3O2 and a molecular weight of 453.67 g/mol. Its IUPAC name is N-[2-amino-3-(5-chloro-7-iodoquinolin-8-yl)oxyphenyl]acetamide.
| Compound Name | N-[2-amino-3-(5-chloro-7-iodoquinolin-8-yl)oxyphenyl]acetamide |
|---|---|
| PubChem CID | 172655091 |
| Molecular Formula | C17H13ClIN3O2 |
| Molecular Weight | 453.67 g/mol |
| Exact Mass | 452.97 |
| IUPAC Name | N-[2-amino-3-(5-chloro-7-iodoquinolin-8-yl)oxyphenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(Oc2c(I)cc(Cl)c3cccnc23)c1N |
| InChI | InChI=1S/C17H13ClIN3O2/c1-9(23)22-13-5-2-6-14(15(13)20)24-17-12(19)8-11(18)10-4-3-7-21-16(10)17/h2-8H,20H2,1H3,(H,22,23) |
| InChIKey | KMLHLWJPMOZRAH-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.67 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|