C24H18ClN5O2 — CID 174320356
[5-chloro-7-[(4-cyanophenyl)-(pyrimidin-2-ylamino)methyl]quinolin-8-yl] propanoate (PubChem CID 174320356) has the molecular formula C24H18ClN5O2 and a molecular weight of 443.89 g/mol. Its IUPAC name is [5-chloro-7-[(4-cyanophenyl)-(pyrimidin-2-ylamino)methyl]quinolin-8-yl] propanoate.
| Compound Name | [5-chloro-7-[(4-cyanophenyl)-(pyrimidin-2-ylamino)methyl]quinolin-8-yl] propanoate |
|---|---|
| PubChem CID | 174320356 |
| Molecular Formula | C24H18ClN5O2 |
| Molecular Weight | 443.89 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | [5-chloro-7-[(4-cyanophenyl)-(pyrimidin-2-ylamino)methyl]quinolin-8-yl] propanoate |
| SMILES | CCC(=O)Oc1c(C(Nc2ncccn2)c2ccc(C#N)cc2)cc(Cl)c2cccnc12 |
| InChI | InChI=1S/C24H18ClN5O2/c1-2-20(31)32-23-18(13-19(25)17-5-3-10-27-22(17)23)21(30-24-28-11-4-12-29-24)16-8-6-15(14-26)7-9-16/h3-13,21H,2H2,1H3,(H,28,29,30) |
| InChIKey | VXTQOPXNYLRUJO-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.89 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|