C23H27Cl2N3O4 — CID 176554002
[2-[(2,3-dichlorophenyl)-[[(NZ)-N'-methyl-N-propylidenecarbamimidoyl]amino]methyl]phenoxy]methyl propan-2-yl carbonate (PubChem CID 176554002) has the molecular formula C23H27Cl2N3O4 and a molecular weight of 480.39 g/mol. Its IUPAC name is [2-[(2,3-dichlorophenyl)-[[(NZ)-N'-methyl-N-propylidenecarbamimidoyl]amino]methyl]phenoxy]methyl propan-2-yl carbonate.
| Compound Name | [2-[(2,3-dichlorophenyl)-[[(NZ)-N'-methyl-N-propylidenecarbamimidoyl]amino]methyl]phenoxy]methyl propan-2-yl carbonate |
|---|---|
| PubChem CID | 176554002 |
| Molecular Formula | C23H27Cl2N3O4 |
| Molecular Weight | 480.39 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | [2-[(2,3-dichlorophenyl)-[[(NZ)-N'-methyl-N-propylidenecarbamimidoyl]amino]methyl]phenoxy]methyl propan-2-yl carbonate |
| SMILES | CC/C=N\C(=N/C)NC(c1ccccc1OCOC(=O)OC(C)C)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C23H27Cl2N3O4/c1-5-13-27-22(26-4)28-21(17-10-8-11-18(24)20(17)25)16-9-6-7-12-19(16)30-14-31-23(29)32-15(2)3/h6-13,15,21H,5,14H2,1-4H3,(H,26,28)/b27-13- |
| InChIKey | IYDSSRCKCPLELI-WKIKZPBSSA-N |
| XLogP | 6.04 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.39 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|