C22H25Cl3N4O4 — CID 176553940
[4-chloro-2-[(4,5-dichloro-3-pyridinyl)-[[(NZ)-N'-methyl-N-propylidenecarbamimidoyl]amino]methyl]phenoxy]methyl propan-2-yl carbonate (PubChem CID 176553940) has the molecular formula C22H25Cl3N4O4 and a molecular weight of 515.83 g/mol. Its IUPAC name is [4-chloro-2-[(4,5-dichloro-3-pyridinyl)-[[(NZ)-N'-methyl-N-propylidenecarbamimidoyl]amino]methyl]phenoxy]methyl propan-2-yl carbonate.
| Compound Name | [4-chloro-2-[(4,5-dichloro-3-pyridinyl)-[[(NZ)-N'-methyl-N-propylidenecarbamimidoyl]amino]methyl]phenoxy]methyl propan-2-yl carbonate |
|---|---|
| PubChem CID | 176553940 |
| Molecular Formula | C22H25Cl3N4O4 |
| Molecular Weight | 515.83 g/mol |
| Exact Mass | 514.09 |
| IUPAC Name | [4-chloro-2-[(4,5-dichloro-3-pyridinyl)-[[(NZ)-N'-methyl-N-propylidenecarbamimidoyl]amino]methyl]phenoxy]methyl propan-2-yl carbonate |
| SMILES | CC/C=N\C(=N/C)NC(c1cc(Cl)ccc1OCOC(=O)OC(C)C)c1cncc(Cl)c1Cl |
| InChI | InChI=1S/C22H25Cl3N4O4/c1-5-8-28-21(26-4)29-20(16-10-27-11-17(24)19(16)25)15-9-14(23)6-7-18(15)31-12-32-22(30)33-13(2)3/h6-11,13,20H,5,12H2,1-4H3,(H,26,29)/b28-8- |
| InChIKey | GHDHVBRRYCSFEO-IJFXDBOGSA-N |
| XLogP | 6.09 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.83 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|