C16H23ClN2O2 — CID 62072702
2-[4-chloro-2-[1-(ethylamino)ethyl]phenoxy]-N-cyclopropyl-N-methylacetamide (PubChem CID 62072702) has the molecular formula C16H23ClN2O2 and a molecular weight of 310.83 g/mol. Its IUPAC name is 2-[4-chloro-2-[1-(ethylamino)ethyl]phenoxy]-N-cyclopropyl-N-methylacetamide.
| Compound Name | 2-[4-chloro-2-[1-(ethylamino)ethyl]phenoxy]-N-cyclopropyl-N-methylacetamide |
|---|---|
| PubChem CID | 62072702 |
| Molecular Formula | C16H23ClN2O2 |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 2-[4-chloro-2-[1-(ethylamino)ethyl]phenoxy]-N-cyclopropyl-N-methylacetamide |
| SMILES | CCNC(C)c1cc(Cl)ccc1OCC(=O)N(C)C1CC1 |
| InChI | InChI=1S/C16H23ClN2O2/c1-4-18-11(2)14-9-12(17)5-8-15(14)21-10-16(20)19(3)13-6-7-13/h5,8-9,11,13,18H,4,6-7,10H2,1-3H3 |
| InChIKey | DOFYZVYFUBHDSF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |