C12H15ClN2O2 — CID 54956878
2-(2-amino-4-chlorophenoxy)-N-cyclopropyl-N-methylacetamide (PubChem CID 54956878) has the molecular formula C12H15ClN2O2 and a molecular weight of 254.72 g/mol. Its IUPAC name is 2-(2-amino-4-chlorophenoxy)-N-cyclopropyl-N-methylacetamide.
| Compound Name | 2-(2-amino-4-chlorophenoxy)-N-cyclopropyl-N-methylacetamide |
|---|---|
| PubChem CID | 54956878 |
| Molecular Formula | C12H15ClN2O2 |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 2-(2-amino-4-chlorophenoxy)-N-cyclopropyl-N-methylacetamide |
| SMILES | CN(C(=O)COc1ccc(Cl)cc1N)C1CC1 |
| InChI | InChI=1S/C12H15ClN2O2/c1-15(9-3-4-9)12(16)7-17-11-5-2-8(13)6-10(11)14/h2,5-6,9H,3-4,7,14H2,1H3 |
| InChIKey | RPCRFMNKYDMOPA-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|