C9H15N3 — CID 22118535
1-N'-pyridin-2-ylbutane-1,1-diamine (PubChem CID 22118535) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is 1-N'-pyridin-2-ylbutane-1,1-diamine.
| Compound Name | 1-N'-pyridin-2-ylbutane-1,1-diamine |
|---|---|
| PubChem CID | 22118535 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 1-N'-pyridin-2-ylbutane-1,1-diamine |
| SMILES | CCCC(N)Nc1ccccn1 |
| InChI | InChI=1S/C9H15N3/c1-2-5-8(10)12-9-6-3-4-7-11-9/h3-4,6-8H,2,5,10H2,1H3,(H,11,12) |
| InChIKey | JEFDZRAWSQKIAL-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|