About N-ethylpropan-2-amine;methane;N-propan-2-ylpyridin-2-amine
N-ethylpropan-2-amine;methane;N-propan-2-ylpyridin-2-amine (PubChem CID 158791390) has the molecular formula C14H29N3
and a molecular weight of 239.41 g/mol. Its IUPAC name is N-ethylpropan-2-amine;methane;N-propan-2-ylpyridin-2-amine.
Molecular Properties
| Compound Name | N-ethylpropan-2-amine;methane;N-propan-2-ylpyridin-2-amine |
| PubChem CID | 158791390 |
| Molecular Formula | C14H29N3 |
| Molecular Weight | 239.41 g/mol |
| Exact Mass | 239.24 |
| IUPAC Name | N-ethylpropan-2-amine;methane;N-propan-2-ylpyridin-2-amine |
| SMILES | C.CC(C)Nc1ccccn1.CCNC(C)C |
| InChI | InChI=1S/C8H12N2.C5H13N.CH4/c1-7(2)10-8-5-3-4-6-9-8;1-4-6-5(2)3;/h3-7H,1-2H3,(H,9,10);5-6H,4H2,1-3H3;1H4 |
| InChIKey | ISHYGTMDDLZVMM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethylpropan-2-amine;methane;N-propan-2-ylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylpropan-2-amine;methane;N-propan-2-ylpyridin-2-amine?
The IUPAC name of N-ethylpropan-2-amine;methane;N-propan-2-ylpyridin-2-amine (CID 158791390) is N-ethylpropan-2-amine;methane;N-propan-2-ylpyridin-2-amine.
What is the SMILES notation for N-ethylpropan-2-amine;methane;N-propan-2-ylpyridin-2-amine?
The canonical SMILES for N-ethylpropan-2-amine;methane;N-propan-2-ylpyridin-2-amine is C.CC(C)Nc1ccccn1.CCNC(C)C.
What is the InChIKey of N-ethylpropan-2-amine;methane;N-propan-2-ylpyridin-2-amine?
The InChIKey is ISHYGTMDDLZVMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2.C5H13N.CH4/c1-7(2)10-8-5-3-4-6-9-8;1-4-6-5(2)3;/h3-7H,1-2H3,(H,9,10);5-6H,4H2,1-3H3;1H4.
What are the key properties of N-ethylpropan-2-amine;methane;N-propan-2-ylpyridin-2-amine?
N-ethylpropan-2-amine;methane;N-propan-2-ylpyridin-2-amine has a molecular weight of 239.41 g/mol, XLogP of 3.54, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylpropan-2-amine;methane;N-propan-2-ylpyridin-2-amine is sourced from PubChem (CID 158791390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).