About dichlorocobalt;N-propan-2-ylpyridin-2-amine
dichlorocobalt;N-propan-2-ylpyridin-2-amine (PubChem CID 175191424) has the molecular formula C8H12Cl2CoN2
and a molecular weight of 266.04 g/mol. Its IUPAC name is dichlorocobalt;N-propan-2-ylpyridin-2-amine.
Molecular Properties
| Compound Name | dichlorocobalt;N-propan-2-ylpyridin-2-amine |
| PubChem CID | 175191424 |
| Molecular Formula | C8H12Cl2CoN2 |
| Molecular Weight | 266.04 g/mol |
| Exact Mass | 264.97 |
| IUPAC Name | dichlorocobalt;N-propan-2-ylpyridin-2-amine |
| SMILES | CC(C)Nc1ccccn1.Cl[Co]Cl |
| InChI | InChI=1S/C8H12N2.2ClH.Co/c1-7(2)10-8-5-3-4-6-9-8;;;/h3-7H,1-2H3,(H,9,10);2*1H;/q;;;+2/p-2 |
| InChIKey | KMEQLBUDQGVIRJ-UHFFFAOYSA-L |
| XLogP | 3.28 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.04 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze dichlorocobalt;N-propan-2-ylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorocobalt;N-propan-2-ylpyridin-2-amine?
The IUPAC name of dichlorocobalt;N-propan-2-ylpyridin-2-amine (CID 175191424) is dichlorocobalt;N-propan-2-ylpyridin-2-amine.
What is the SMILES notation for dichlorocobalt;N-propan-2-ylpyridin-2-amine?
The canonical SMILES for dichlorocobalt;N-propan-2-ylpyridin-2-amine is CC(C)Nc1ccccn1.Cl[Co]Cl.
What is the InChIKey of dichlorocobalt;N-propan-2-ylpyridin-2-amine?
The InChIKey is KMEQLBUDQGVIRJ-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H12N2.2ClH.Co/c1-7(2)10-8-5-3-4-6-9-8;;;/h3-7H,1-2H3,(H,9,10);2*1H;/q;;;+2/p-2.
What are the key properties of dichlorocobalt;N-propan-2-ylpyridin-2-amine?
dichlorocobalt;N-propan-2-ylpyridin-2-amine has a molecular weight of 266.04 g/mol, XLogP of 3.28, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorocobalt;N-propan-2-ylpyridin-2-amine is sourced from PubChem (CID 175191424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).