C26H26N3O2+ — CID 7029562
2-methyl-7-[(R)-[(6-methylpyridin-1-ium-2-yl)amino]-(3-prop-2-enoxyphenyl)methyl]quinolin-8-ol (PubChem CID 7029562) has the molecular formula C26H26N3O2+ and a molecular weight of 412.51 g/mol. Its IUPAC name is 2-methyl-7-[(R)-[(6-methylpyridin-1-ium-2-yl)amino]-(3-prop-2-enoxyphenyl)methyl]quinolin-8-ol.
| Compound Name | 2-methyl-7-[(R)-[(6-methylpyridin-1-ium-2-yl)amino]-(3-prop-2-enoxyphenyl)methyl]quinolin-8-ol |
|---|---|
| PubChem CID | 7029562 |
| Molecular Formula | C26H26N3O2+ |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 2-methyl-7-[(R)-[(6-methylpyridin-1-ium-2-yl)amino]-(3-prop-2-enoxyphenyl)methyl]quinolin-8-ol |
| SMILES | C=CCOc1cccc([C@@H](Nc2cccc(C)[nH+]2)c2ccc3ccc(C)nc3c2O)c1 |
| InChI | InChI=1S/C26H25N3O2/c1-4-15-31-21-9-6-8-20(16-21)24(29-23-10-5-7-17(2)27-23)22-14-13-19-12-11-18(3)28-25(19)26(22)30/h4-14,16,24,30H,1,15H2,2-3H3,(H,27,29)/p+1/t24-/m1/s1 |
| InChIKey | FJGCIPBPZJRWFH-XMMPIXPASA-O |
| XLogP | 5.14 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|