C24H24N3O3+ — CID 7500221
7-[(R)-(3-ethoxy-2-hydroxyphenyl)-(pyridin-1-ium-2-ylamino)methyl]-2-methylquinolin-8-ol (PubChem CID 7500221) has the molecular formula C24H24N3O3+ and a molecular weight of 402.47 g/mol. Its IUPAC name is 7-[(R)-(3-ethoxy-2-hydroxyphenyl)-(pyridin-1-ium-2-ylamino)methyl]-2-methylquinolin-8-ol.
| Compound Name | 7-[(R)-(3-ethoxy-2-hydroxyphenyl)-(pyridin-1-ium-2-ylamino)methyl]-2-methylquinolin-8-ol |
|---|---|
| PubChem CID | 7500221 |
| Molecular Formula | C24H24N3O3+ |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 7-[(R)-(3-ethoxy-2-hydroxyphenyl)-(pyridin-1-ium-2-ylamino)methyl]-2-methylquinolin-8-ol |
| SMILES | CCOc1cccc([C@H](Nc2cccc[nH+]2)c2ccc3ccc(C)nc3c2O)c1O |
| InChI | InChI=1S/C24H23N3O3/c1-3-30-19-8-6-7-17(23(19)28)22(27-20-9-4-5-14-25-20)18-13-12-16-11-10-15(2)26-21(16)24(18)29/h4-14,22,28-29H,3H2,1-2H3,(H,25,27)/p+1/t22-/m0/s1 |
| InChIKey | HJOYWNZTRJUEOI-QFIPXVFZSA-O |
| XLogP | 4.37 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|