C23H21N4O3+ — CID 7439828
2-methyl-7-[(R)-[(4-methylpyridin-1-ium-2-yl)amino]-(2-nitrophenyl)methyl]quinolin-8-ol (PubChem CID 7439828) has the molecular formula C23H21N4O3+ and a molecular weight of 401.45 g/mol. Its IUPAC name is 2-methyl-7-[(R)-[(4-methylpyridin-1-ium-2-yl)amino]-(2-nitrophenyl)methyl]quinolin-8-ol.
| Compound Name | 2-methyl-7-[(R)-[(4-methylpyridin-1-ium-2-yl)amino]-(2-nitrophenyl)methyl]quinolin-8-ol |
|---|---|
| PubChem CID | 7439828 |
| Molecular Formula | C23H21N4O3+ |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 2-methyl-7-[(R)-[(4-methylpyridin-1-ium-2-yl)amino]-(2-nitrophenyl)methyl]quinolin-8-ol |
| SMILES | Cc1cc[nH+]c(N[C@H](c2ccccc2[N+](=O)[O-])c2ccc3ccc(C)nc3c2O)c1 |
| InChI | InChI=1S/C23H20N4O3/c1-14-11-12-24-20(13-14)26-22(17-5-3-4-6-19(17)27(29)30)18-10-9-16-8-7-15(2)25-21(16)23(18)28/h3-13,22,28H,1-2H3,(H,24,26)/p+1/t22-/m1/s1 |
| InChIKey | VXPGAZJVEWWXED-JOCHJYFZSA-O |
| XLogP | 4.48 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|