C23H22N2O6 — CID 4689214
5-[[3-carboxy-4-(2-methylprop-2-enoylamino)phenyl]methyl]-2-(2-methylprop-2-enoylamino)benzoic acid (PubChem CID 4689214) has the molecular formula C23H22N2O6 and a molecular weight of 422.44 g/mol. Its IUPAC name is 5-[[3-carboxy-4-(2-methylprop-2-enoylamino)phenyl]methyl]-2-(2-methylprop-2-enoylamino)benzoic acid.
| Compound Name | 5-[[3-carboxy-4-(2-methylprop-2-enoylamino)phenyl]methyl]-2-(2-methylprop-2-enoylamino)benzoic acid |
|---|---|
| PubChem CID | 4689214 |
| Molecular Formula | C23H22N2O6 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 5-[[3-carboxy-4-(2-methylprop-2-enoylamino)phenyl]methyl]-2-(2-methylprop-2-enoylamino)benzoic acid |
| SMILES | C=C(C)C(=O)Nc1ccc(Cc2ccc(NC(=O)C(=C)C)c(C(=O)O)c2)cc1C(=O)O |
| InChI | InChI=1S/C23H22N2O6/c1-12(2)20(26)24-18-7-5-14(10-16(18)22(28)29)9-15-6-8-19(17(11-15)23(30)31)25-21(27)13(3)4/h5-8,10-11H,1,3,9H2,2,4H3,(H,24,26)(H,25,27)(H,28,29)(H,30,31) |
| InChIKey | AGAIXRGHZDYDMU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|