C32H28N2O3 — CID 142938275
5-[[3-acetyl-4-(1-phenylethenylamino)phenyl]methyl]-2-(1-phenylethenylamino)benzoic acid (PubChem CID 142938275) has the molecular formula C32H28N2O3 and a molecular weight of 488.59 g/mol. Its IUPAC name is 5-[[3-acetyl-4-(1-phenylethenylamino)phenyl]methyl]-2-(1-phenylethenylamino)benzoic acid.
| Compound Name | 5-[[3-acetyl-4-(1-phenylethenylamino)phenyl]methyl]-2-(1-phenylethenylamino)benzoic acid |
|---|---|
| PubChem CID | 142938275 |
| Molecular Formula | C32H28N2O3 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 5-[[3-acetyl-4-(1-phenylethenylamino)phenyl]methyl]-2-(1-phenylethenylamino)benzoic acid |
| SMILES | C=C(Nc1ccc(Cc2ccc(NC(=C)c3ccccc3)c(C(=O)O)c2)cc1C(C)=O)c1ccccc1 |
| InChI | InChI=1S/C32H28N2O3/c1-21(26-10-6-4-7-11-26)33-30-16-14-24(19-28(30)23(3)35)18-25-15-17-31(29(20-25)32(36)37)34-22(2)27-12-8-5-9-13-27/h4-17,19-20,33-34H,1-2,18H2,3H3,(H,36,37) |
| InChIKey | NVUVYZDPVXTIPF-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |