C20H11F3N2O3S — CID 118001256
4-[2-(3,4-dicyano-2,5,6-trifluorophenyl)ethyl]naphthalene-2-sulfonic acid (PubChem CID 118001256) has the molecular formula C20H11F3N2O3S and a molecular weight of 416.38 g/mol. Its IUPAC name is 4-[2-(3,4-dicyano-2,5,6-trifluorophenyl)ethyl]naphthalene-2-sulfonic acid.
| Compound Name | 4-[2-(3,4-dicyano-2,5,6-trifluorophenyl)ethyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 118001256 |
| Molecular Formula | C20H11F3N2O3S |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | 4-[2-(3,4-dicyano-2,5,6-trifluorophenyl)ethyl]naphthalene-2-sulfonic acid |
| SMILES | N#Cc1c(F)c(F)c(CCc2cc(S(=O)(=O)O)cc3ccccc23)c(F)c1C#N |
| InChI | InChI=1S/C20H11F3N2O3S/c21-18-15(19(22)20(23)17(10-25)16(18)9-24)6-5-12-8-13(29(26,27)28)7-11-3-1-2-4-14(11)12/h1-4,7-8H,5-6H2,(H,26,27,28) |
| InChIKey | RZSMDXCNWIFACH-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 101.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|