C18H7F3N2O4S — CID 169036345
5-(3,4-dicyano-2,5,6-trifluorophenoxy)naphthalene-2-sulfonic acid (PubChem CID 169036345) has the molecular formula C18H7F3N2O4S and a molecular weight of 404.33 g/mol. Its IUPAC name is 5-(3,4-dicyano-2,5,6-trifluorophenoxy)naphthalene-2-sulfonic acid.
| Compound Name | 5-(3,4-dicyano-2,5,6-trifluorophenoxy)naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 169036345 |
| Molecular Formula | C18H7F3N2O4S |
| Molecular Weight | 404.33 g/mol |
| Exact Mass | 404.01 |
| IUPAC Name | 5-(3,4-dicyano-2,5,6-trifluorophenoxy)naphthalene-2-sulfonic acid |
| SMILES | N#Cc1c(F)c(F)c(Oc2cccc3cc(S(=O)(=O)O)ccc23)c(F)c1C#N |
| InChI | InChI=1S/C18H7F3N2O4S/c19-15-12(7-22)13(8-23)16(20)18(17(15)21)27-14-3-1-2-9-6-10(28(24,25)26)4-5-11(9)14/h1-6H,(H,24,25,26) |
| InChIKey | BBBXOXNILKVDJN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 111.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.33 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|