C18H25N5O9S3 — CID 159641898
2-[[4-[3-(methanesulfonamido)propyl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]methyl]benzene-1,4-disulfonic acid (PubChem CID 159641898) has the molecular formula C18H25N5O9S3 and a molecular weight of 551.63 g/mol. Its IUPAC name is 2-[[4-[3-(methanesulfonamido)propyl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]methyl]benzene-1,4-disulfonic acid.
| Compound Name | 2-[[4-[3-(methanesulfonamido)propyl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]methyl]benzene-1,4-disulfonic acid |
|---|---|
| PubChem CID | 159641898 |
| Molecular Formula | C18H25N5O9S3 |
| Molecular Weight | 551.63 g/mol |
| Exact Mass | 551.08 |
| IUPAC Name | 2-[[4-[3-(methanesulfonamido)propyl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]methyl]benzene-1,4-disulfonic acid |
| SMILES | CS(=O)(=O)NCCCc1nc(Cc2cc(S(=O)(=O)O)ccc2S(=O)(=O)O)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C18H25N5O9S3/c1-33(24,25)19-6-2-3-16-20-17(22-18(21-16)23-7-9-32-10-8-23)12-13-11-14(34(26,27)28)4-5-15(13)35(29,30)31/h4-5,11,19H,2-3,6-10,12H2,1H3,(H,26,27,28)(H,29,30,31) |
| InChIKey | HQKQVWZCXVTKAA-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 206.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.63 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|