C9H12ClNO5S2 — CID 54148909
4-chloro-2-[2-(methanesulfonamido)ethyl]benzenesulfonic acid (PubChem CID 54148909) has the molecular formula C9H12ClNO5S2 and a molecular weight of 313.78 g/mol. Its IUPAC name is 4-chloro-2-[2-(methanesulfonamido)ethyl]benzenesulfonic acid.
| Compound Name | 4-chloro-2-[2-(methanesulfonamido)ethyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 54148909 |
| Molecular Formula | C9H12ClNO5S2 |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 312.98 |
| IUPAC Name | 4-chloro-2-[2-(methanesulfonamido)ethyl]benzenesulfonic acid |
| SMILES | CS(=O)(=O)NCCc1cc(Cl)ccc1S(=O)(=O)O |
| InChI | InChI=1S/C9H12ClNO5S2/c1-17(12,13)11-5-4-7-6-8(10)2-3-9(7)18(14,15)16/h2-3,6,11H,4-5H2,1H3,(H,14,15,16) |
| InChIKey | OGJARJMCHRYGEO-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|