C19H26N4O5S — CID 158022567
3-[[4-butyl-6-[(4-sulfophenyl)methyl]-1,3,5-triazin-2-yl]-ethylamino]propanoic acid (PubChem CID 158022567) has the molecular formula C19H26N4O5S and a molecular weight of 422.51 g/mol. Its IUPAC name is 3-[[4-butyl-6-[(4-sulfophenyl)methyl]-1,3,5-triazin-2-yl]-ethylamino]propanoic acid.
| Compound Name | 3-[[4-butyl-6-[(4-sulfophenyl)methyl]-1,3,5-triazin-2-yl]-ethylamino]propanoic acid |
|---|---|
| PubChem CID | 158022567 |
| Molecular Formula | C19H26N4O5S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 3-[[4-butyl-6-[(4-sulfophenyl)methyl]-1,3,5-triazin-2-yl]-ethylamino]propanoic acid |
| SMILES | CCCCc1nc(Cc2ccc(S(=O)(=O)O)cc2)nc(N(CC)CCC(=O)O)n1 |
| InChI | InChI=1S/C19H26N4O5S/c1-3-5-6-16-20-17(13-14-7-9-15(10-8-14)29(26,27)28)22-19(21-16)23(4-2)12-11-18(24)25/h7-10H,3-6,11-13H2,1-2H3,(H,24,25)(H,26,27,28) |
| InChIKey | HGBUEPYBXCMXHN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 133.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|