C18H26N6O7S2 — CID 123193521
3-[ethyl-[4-[3-(methanesulfonamido)propyl]-6-(4-sulfoanilino)-1,3,5-triazin-2-yl]amino]propanoic acid (PubChem CID 123193521) has the molecular formula C18H26N6O7S2 and a molecular weight of 502.58 g/mol. Its IUPAC name is 3-[ethyl-[4-[3-(methanesulfonamido)propyl]-6-(4-sulfoanilino)-1,3,5-triazin-2-yl]amino]propanoic acid.
| Compound Name | 3-[ethyl-[4-[3-(methanesulfonamido)propyl]-6-(4-sulfoanilino)-1,3,5-triazin-2-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 123193521 |
| Molecular Formula | C18H26N6O7S2 |
| Molecular Weight | 502.58 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | 3-[ethyl-[4-[3-(methanesulfonamido)propyl]-6-(4-sulfoanilino)-1,3,5-triazin-2-yl]amino]propanoic acid |
| SMILES | CCN(CCC(=O)O)c1nc(CCCNS(C)(=O)=O)nc(Nc2ccc(S(=O)(=O)O)cc2)n1 |
| InChI | InChI=1S/C18H26N6O7S2/c1-3-24(12-10-16(25)26)18-22-15(5-4-11-19-32(2,27)28)21-17(23-18)20-13-6-8-14(9-7-13)33(29,30)31/h6-9,19H,3-5,10-12H2,1-2H3,(H,25,26)(H,29,30,31)(H,20,21,22,23) |
| InChIKey | HUBLFLCCFWGGQJ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 191.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.58 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|