C14H16O3S4 — CID 22353887
4-[(3-butyl-5-sulfanylidenedithiol-4-yl)methyl]benzenesulfonic acid (PubChem CID 22353887) has the molecular formula C14H16O3S4 and a molecular weight of 360.55 g/mol. Its IUPAC name is 4-[(3-butyl-5-sulfanylidenedithiol-4-yl)methyl]benzenesulfonic acid.
| Compound Name | 4-[(3-butyl-5-sulfanylidenedithiol-4-yl)methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 22353887 |
| Molecular Formula | C14H16O3S4 |
| Molecular Weight | 360.55 g/mol |
| Exact Mass | 360.00 |
| IUPAC Name | 4-[(3-butyl-5-sulfanylidenedithiol-4-yl)methyl]benzenesulfonic acid |
| SMILES | CCCCc1ssc(=S)c1Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C14H16O3S4/c1-2-3-4-13-12(14(18)20-19-13)9-10-5-7-11(8-6-10)21(15,16)17/h5-8H,2-4,9H2,1H3,(H,15,16,17) |
| InChIKey | JMIQLOCSZXQDJN-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.55 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|