C17H15NaO3S4 — CID 173346344
sodium;hydride;4-[[3-(3-methylphenyl)-5-sulfanylidenedithiol-4-yl]methyl]benzenesulfonic acid (PubChem CID 173346344) has the molecular formula C17H15NaO3S4 and a molecular weight of 418.56 g/mol. Its IUPAC name is sodium;hydride;4-[[3-(3-methylphenyl)-5-sulfanylidenedithiol-4-yl]methyl]benzenesulfonic acid.
| Compound Name | sodium;hydride;4-[[3-(3-methylphenyl)-5-sulfanylidenedithiol-4-yl]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 173346344 |
| Molecular Formula | C17H15NaO3S4 |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 417.98 |
| IUPAC Name | sodium;hydride;4-[[3-(3-methylphenyl)-5-sulfanylidenedithiol-4-yl]methyl]benzenesulfonic acid |
| SMILES | Cc1cccc(-c2ssc(=S)c2Cc2ccc(S(=O)(=O)O)cc2)c1.[H-].[Na+] |
| InChI | InChI=1S/C17H14O3S4.Na.H/c1-11-3-2-4-13(9-11)16-15(17(21)23-22-16)10-12-5-7-14(8-6-12)24(18,19)20;;/h2-9H,10H2,1H3,(H,18,19,20);;/q;+1;-1 |
| InChIKey | VHFYTTRAKXIXJK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|