C17H14O3S4 — CID 22353866
4-[[3-(2-methylphenyl)-5-sulfanylidenedithiol-4-yl]methyl]benzenesulfonic acid (PubChem CID 22353866) has the molecular formula C17H14O3S4 and a molecular weight of 394.56 g/mol. Its IUPAC name is 4-[[3-(2-methylphenyl)-5-sulfanylidenedithiol-4-yl]methyl]benzenesulfonic acid.
| Compound Name | 4-[[3-(2-methylphenyl)-5-sulfanylidenedithiol-4-yl]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 22353866 |
| Molecular Formula | C17H14O3S4 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 393.98 |
| IUPAC Name | 4-[[3-(2-methylphenyl)-5-sulfanylidenedithiol-4-yl]methyl]benzenesulfonic acid |
| SMILES | Cc1ccccc1-c1ssc(=S)c1Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C17H14O3S4/c1-11-4-2-3-5-14(11)16-15(17(21)23-22-16)10-12-6-8-13(9-7-12)24(18,19)20/h2-9H,10H2,1H3,(H,18,19,20) |
| InChIKey | AETAYZGILNAQQW-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|