C20H18O9S3 — CID 141014421
3-[(2-sulfophenyl)methyl]-4-[(4-sulfophenyl)methyl]benzenesulfonic acid (PubChem CID 141014421) has the molecular formula C20H18O9S3 and a molecular weight of 498.56 g/mol. Its IUPAC name is 3-[(2-sulfophenyl)methyl]-4-[(4-sulfophenyl)methyl]benzenesulfonic acid.
| Compound Name | 3-[(2-sulfophenyl)methyl]-4-[(4-sulfophenyl)methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 141014421 |
| Molecular Formula | C20H18O9S3 |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.01 |
| IUPAC Name | 3-[(2-sulfophenyl)methyl]-4-[(4-sulfophenyl)methyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(Cc2ccc(S(=O)(=O)O)cc2Cc2ccccc2S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C20H18O9S3/c21-30(22,23)18-8-5-14(6-9-18)11-15-7-10-19(31(24,25)26)13-17(15)12-16-3-1-2-4-20(16)32(27,28)29/h1-10,13H,11-12H2,(H,21,22,23)(H,24,25,26)(H,27,28,29) |
| InChIKey | RYNDAVCWCAMBGA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 163.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|