C13H14N2O6S2 — CID 169386947
2-[(2-phenylhydrazinyl)methyl]benzene-1,4-disulfonic acid (PubChem CID 169386947) has the molecular formula C13H14N2O6S2 and a molecular weight of 358.40 g/mol. Its IUPAC name is 2-[(2-phenylhydrazinyl)methyl]benzene-1,4-disulfonic acid.
| Compound Name | 2-[(2-phenylhydrazinyl)methyl]benzene-1,4-disulfonic acid |
|---|---|
| PubChem CID | 169386947 |
| Molecular Formula | C13H14N2O6S2 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | 2-[(2-phenylhydrazinyl)methyl]benzene-1,4-disulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(S(=O)(=O)O)c(CNNc2ccccc2)c1 |
| InChI | InChI=1S/C13H14N2O6S2/c16-22(17,18)12-6-7-13(23(19,20)21)10(8-12)9-14-15-11-4-2-1-3-5-11/h1-8,14-15H,9H2,(H,16,17,18)(H,19,20,21) |
| InChIKey | ODUFXDWSRKCBSC-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|