C18H16O4S4 — CID 22353927
4-methoxy-2-[[3-(4-methylphenyl)-5-sulfanylidenedithiol-4-yl]methyl]benzenesulfonic acid (PubChem CID 22353927) has the molecular formula C18H16O4S4 and a molecular weight of 424.59 g/mol. Its IUPAC name is 4-methoxy-2-[[3-(4-methylphenyl)-5-sulfanylidenedithiol-4-yl]methyl]benzenesulfonic acid.
| Compound Name | 4-methoxy-2-[[3-(4-methylphenyl)-5-sulfanylidenedithiol-4-yl]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 22353927 |
| Molecular Formula | C18H16O4S4 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 423.99 |
| IUPAC Name | 4-methoxy-2-[[3-(4-methylphenyl)-5-sulfanylidenedithiol-4-yl]methyl]benzenesulfonic acid |
| SMILES | COc1ccc(S(=O)(=O)O)c(Cc2c(-c3ccc(C)cc3)ssc2=S)c1 |
| InChI | InChI=1S/C18H16O4S4/c1-11-3-5-12(6-4-11)17-15(18(23)25-24-17)10-13-9-14(22-2)7-8-16(13)26(19,20)21/h3-9H,10H2,1-2H3,(H,19,20,21) |
| InChIKey | CYBIXLSBBCNYPW-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|