C18H25N3O5S — CID 173158555
N'-amino-3-(2,5-dimethoxyphenyl)propanimidamide;4-methylbenzenesulfonic acid (PubChem CID 173158555) has the molecular formula C18H25N3O5S and a molecular weight of 395.48 g/mol. Its IUPAC name is N'-amino-3-(2,5-dimethoxyphenyl)propanimidamide;4-methylbenzenesulfonic acid.
| Compound Name | N'-amino-3-(2,5-dimethoxyphenyl)propanimidamide;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 173158555 |
| Molecular Formula | C18H25N3O5S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | N'-amino-3-(2,5-dimethoxyphenyl)propanimidamide;4-methylbenzenesulfonic acid |
| SMILES | COc1ccc(OC)c(CCC(N)=NN)c1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C11H17N3O2.C7H8O3S/c1-15-9-4-5-10(16-2)8(7-9)3-6-11(12)14-13;1-6-2-4-7(5-3-6)11(8,9)10/h4-5,7H,3,6,13H2,1-2H3,(H2,12,14);2-5H,1H3,(H,8,9,10) |
| InChIKey | QTIROBKSSCECFS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 137.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|