C35H36O4S — CID 175089582
2-[2-[4-[6-methoxy-2-(4-propan-2-ylphenyl)-3,4-dihydronaphthalen-1-yl]phenyl]ethyl]-4-methylbenzenesulfonic acid (PubChem CID 175089582) has the molecular formula C35H36O4S and a molecular weight of 552.74 g/mol. Its IUPAC name is 2-[2-[4-[6-methoxy-2-(4-propan-2-ylphenyl)-3,4-dihydronaphthalen-1-yl]phenyl]ethyl]-4-methylbenzenesulfonic acid.
| Compound Name | 2-[2-[4-[6-methoxy-2-(4-propan-2-ylphenyl)-3,4-dihydronaphthalen-1-yl]phenyl]ethyl]-4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 175089582 |
| Molecular Formula | C35H36O4S |
| Molecular Weight | 552.74 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | 2-[2-[4-[6-methoxy-2-(4-propan-2-ylphenyl)-3,4-dihydronaphthalen-1-yl]phenyl]ethyl]-4-methylbenzenesulfonic acid |
| SMILES | COc1ccc2c(c1)CCC(c1ccc(C(C)C)cc1)=C2c1ccc(CCc2cc(C)ccc2S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C35H36O4S/c1-23(2)26-12-14-27(15-13-26)32-18-16-29-22-31(39-4)17-19-33(29)35(32)28-9-6-25(7-10-28)8-11-30-21-24(3)5-20-34(30)40(36,37)38/h5-7,9-10,12-15,17,19-23H,8,11,16,18H2,1-4H3,(H,36,37,38) |
| InChIKey | CQTNTUIEPBQBER-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.74 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|