C20H21BrO — CID 139336496
4-bromo-7-methoxy-3-(4-propan-2-ylphenyl)-1,2-dihydronaphthalene (PubChem CID 139336496) has the molecular formula C20H21BrO and a molecular weight of 357.29 g/mol. Its IUPAC name is 4-bromo-7-methoxy-3-(4-propan-2-ylphenyl)-1,2-dihydronaphthalene.
| Compound Name | 4-bromo-7-methoxy-3-(4-propan-2-ylphenyl)-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 139336496 |
| Molecular Formula | C20H21BrO |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 4-bromo-7-methoxy-3-(4-propan-2-ylphenyl)-1,2-dihydronaphthalene |
| SMILES | COc1ccc2c(c1)CCC(c1ccc(C(C)C)cc1)=C2Br |
| InChI | InChI=1S/C20H21BrO/c1-13(2)14-4-6-15(7-5-14)18-10-8-16-12-17(22-3)9-11-19(16)20(18)21/h4-7,9,11-13H,8,10H2,1-3H3 |
| InChIKey | PZCZYOVGWUPODZ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|