C15H18O4S4 — CID 22353845
5-[(3-butyl-5-sulfanylidenedithiol-4-yl)methyl]-2-methoxybenzenesulfonic acid (PubChem CID 22353845) has the molecular formula C15H18O4S4 and a molecular weight of 390.57 g/mol. Its IUPAC name is 5-[(3-butyl-5-sulfanylidenedithiol-4-yl)methyl]-2-methoxybenzenesulfonic acid.
| Compound Name | 5-[(3-butyl-5-sulfanylidenedithiol-4-yl)methyl]-2-methoxybenzenesulfonic acid |
|---|---|
| PubChem CID | 22353845 |
| Molecular Formula | C15H18O4S4 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.01 |
| IUPAC Name | 5-[(3-butyl-5-sulfanylidenedithiol-4-yl)methyl]-2-methoxybenzenesulfonic acid |
| SMILES | CCCCc1ssc(=S)c1Cc1ccc(OC)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C15H18O4S4/c1-3-4-5-13-11(15(20)22-21-13)8-10-6-7-12(19-2)14(9-10)23(16,17)18/h6-7,9H,3-5,8H2,1-2H3,(H,16,17,18) |
| InChIKey | MFIPRAONDSEXCO-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|