C40H42N8O8S — CID 162144481
3-[[4-[[4-[3-carboxypropyl(ethyl)amino]-6-[(4-phenyldiazenylphenyl)methyl]-1,3,5-triazin-2-yl]methyl]-2-methyl-5-(3-sulfopropoxy)phenyl]diazenyl]benzoic acid (PubChem CID 162144481) has the molecular formula C40H42N8O8S and a molecular weight of 794.89 g/mol. Its IUPAC name is 3-[[4-[[4-[3-carboxypropyl(ethyl)amino]-6-[(4-phenyldiazenylphenyl)methyl]-1,3,5-triazin-2-yl]methyl]-2-methyl-5-(3-sulfopropoxy)phenyl]diazenyl]benzoic acid.
| Compound Name | 3-[[4-[[4-[3-carboxypropyl(ethyl)amino]-6-[(4-phenyldiazenylphenyl)methyl]-1,3,5-triazin-2-yl]methyl]-2-methyl-5-(3-sulfopropoxy)phenyl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 162144481 |
| Molecular Formula | C40H42N8O8S |
| Molecular Weight | 794.89 g/mol |
| Exact Mass | 794.28 |
| IUPAC Name | 3-[[4-[[4-[3-carboxypropyl(ethyl)amino]-6-[(4-phenyldiazenylphenyl)methyl]-1,3,5-triazin-2-yl]methyl]-2-methyl-5-(3-sulfopropoxy)phenyl]diazenyl]benzoic acid |
| SMILES | CCN(CCCC(=O)O)c1nc(Cc2ccc(/N=N/c3ccccc3)cc2)nc(Cc2cc(C)c(/N=N/c3cccc(C(=O)O)c3)cc2OCCCS(=O)(=O)O)n1 |
| InChI | InChI=1S/C40H42N8O8S/c1-3-48(19-8-14-38(49)50)40-42-36(23-28-15-17-32(18-16-28)45-44-31-11-5-4-6-12-31)41-37(43-40)25-30-22-27(2)34(26-35(30)56-20-9-21-57(53,54)55)47-46-33-13-7-10-29(24-33)39(51)52/h4-7,10-13,15-18,22,24,26H,3,8-9,14,19-21,23,25H2,1-2H3,(H,49,50)(H,51,52)(H,53,54,55)/b45-44+,47-46+ |
| InChIKey | ONXHDYZYCDFXSI-SWHLYJMESA-N |
| XLogP | 8.24 |
| TPSA | 229.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.89 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|