C21H20O5S2 — CID 19349290
2,4-bis(benzenesulfonyl)-1-propan-2-yloxybenzene (PubChem CID 19349290) has the molecular formula C21H20O5S2 and a molecular weight of 416.52 g/mol. Its IUPAC name is 2,4-bis(benzenesulfonyl)-1-propan-2-yloxybenzene.
| Compound Name | 2,4-bis(benzenesulfonyl)-1-propan-2-yloxybenzene |
|---|---|
| PubChem CID | 19349290 |
| Molecular Formula | C21H20O5S2 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 2,4-bis(benzenesulfonyl)-1-propan-2-yloxybenzene |
| SMILES | CC(C)Oc1ccc(S(=O)(=O)c2ccccc2)cc1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H20O5S2/c1-16(2)26-20-14-13-19(27(22,23)17-9-5-3-6-10-17)15-21(20)28(24,25)18-11-7-4-8-12-18/h3-16H,1-2H3 |
| InChIKey | WDOAPKKBZNFHOG-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |