C14H16KNO6S3 — CID 159894776
potassium;methane;3-[(3-methylsulfinylphenyl)sulfonylamino]benzenesulfonate (PubChem CID 159894776) has the molecular formula C14H16KNO6S3 and a molecular weight of 429.58 g/mol. Its IUPAC name is potassium;methane;3-[(3-methylsulfinylphenyl)sulfonylamino]benzenesulfonate.
| Compound Name | potassium;methane;3-[(3-methylsulfinylphenyl)sulfonylamino]benzenesulfonate |
|---|---|
| PubChem CID | 159894776 |
| Molecular Formula | C14H16KNO6S3 |
| Molecular Weight | 429.58 g/mol |
| Exact Mass | 428.98 |
| IUPAC Name | potassium;methane;3-[(3-methylsulfinylphenyl)sulfonylamino]benzenesulfonate |
| SMILES | C.CS(=O)c1cccc(S(=O)(=O)Nc2cccc(S(=O)(=O)[O-])c2)c1.[K+] |
| InChI | InChI=1S/C13H13NO6S3.CH4.K/c1-21(15)11-5-3-6-12(9-11)22(16,17)14-10-4-2-7-13(8-10)23(18,19)20;;/h2-9,14H,1H3,(H,18,19,20);1H4;/q;;+1/p-1 |
| InChIKey | NVEXHGHYLWJOPD-UHFFFAOYSA-M |
| XLogP | -1.23 |
| TPSA | 120.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.58 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|