C14H17F2N3O — CID 104857456
3-[(1-benzylpyrazol-4-yl)methylamino]-2,2-difluoropropan-1-ol (PubChem CID 104857456) has the molecular formula C14H17F2N3O and a molecular weight of 281.31 g/mol. Its IUPAC name is 3-[(1-benzylpyrazol-4-yl)methylamino]-2,2-difluoropropan-1-ol.
| Compound Name | 3-[(1-benzylpyrazol-4-yl)methylamino]-2,2-difluoropropan-1-ol |
|---|---|
| PubChem CID | 104857456 |
| Molecular Formula | C14H17F2N3O |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 3-[(1-benzylpyrazol-4-yl)methylamino]-2,2-difluoropropan-1-ol |
| SMILES | OCC(F)(F)CNCc1cnn(Cc2ccccc2)c1 |
| InChI | InChI=1S/C14H17F2N3O/c15-14(16,11-20)10-17-6-13-7-18-19(9-13)8-12-4-2-1-3-5-12/h1-5,7,9,17,20H,6,8,10-11H2 |
| InChIKey | XLVSBLXOAKUHKQ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |