C17H25N3O — CID 103708206
4-[(1-benzylpyrazol-4-yl)methylamino]-3,3-dimethylbutan-1-ol (PubChem CID 103708206) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is 4-[(1-benzylpyrazol-4-yl)methylamino]-3,3-dimethylbutan-1-ol.
| Compound Name | 4-[(1-benzylpyrazol-4-yl)methylamino]-3,3-dimethylbutan-1-ol |
|---|---|
| PubChem CID | 103708206 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 4-[(1-benzylpyrazol-4-yl)methylamino]-3,3-dimethylbutan-1-ol |
| SMILES | CC(C)(CCO)CNCc1cnn(Cc2ccccc2)c1 |
| InChI | InChI=1S/C17H25N3O/c1-17(2,8-9-21)14-18-10-16-11-19-20(13-16)12-15-6-4-3-5-7-15/h3-7,11,13,18,21H,8-10,12,14H2,1-2H3 |
| InChIKey | MVDJARJOFPCZRG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |