C13H16N2OS — CID 104755790
2-[(6-methyl-3-pyridinyl)methylamino]-1-thiophen-3-ylethanol (PubChem CID 104755790) has the molecular formula C13H16N2OS and a molecular weight of 248.35 g/mol. Its IUPAC name is 2-[(6-methyl-3-pyridinyl)methylamino]-1-thiophen-3-ylethanol.
| Compound Name | 2-[(6-methyl-3-pyridinyl)methylamino]-1-thiophen-3-ylethanol |
|---|---|
| PubChem CID | 104755790 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 2-[(6-methyl-3-pyridinyl)methylamino]-1-thiophen-3-ylethanol |
| SMILES | Cc1ccc(CNCC(O)c2ccsc2)cn1 |
| InChI | InChI=1S/C13H16N2OS/c1-10-2-3-11(7-15-10)6-14-8-13(16)12-4-5-17-9-12/h2-5,7,9,13-14,16H,6,8H2,1H3 |
| InChIKey | CDXGNABCDJZCLB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |