C10H11NO4S — CID 106434672
(E)-4-[(2-hydroxy-2-thiophen-3-ylethyl)amino]-4-oxobut-2-enoic acid (PubChem CID 106434672) has the molecular formula C10H11NO4S and a molecular weight of 241.27 g/mol. Its IUPAC name is (E)-4-[(2-hydroxy-2-thiophen-3-ylethyl)amino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[(2-hydroxy-2-thiophen-3-ylethyl)amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 106434672 |
| Molecular Formula | C10H11NO4S |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | (E)-4-[(2-hydroxy-2-thiophen-3-ylethyl)amino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)NCC(O)c1ccsc1 |
| InChI | InChI=1S/C10H11NO4S/c12-8(7-3-4-16-6-7)5-11-9(13)1-2-10(14)15/h1-4,6,8,12H,5H2,(H,11,13)(H,14,15)/b2-1+ |
| InChIKey | LEWHLDBQAUPJIB-OWOJBTEDSA-N |
| XLogP | 0.54 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|