C11H20N2S — CID 53274606
N',N'-dimethyl-N-(1-thiophen-3-ylethyl)propane-1,3-diamine (PubChem CID 53274606) has the molecular formula C11H20N2S and a molecular weight of 212.36 g/mol. Its IUPAC name is N',N'-dimethyl-N-(1-thiophen-3-ylethyl)propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-(1-thiophen-3-ylethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 53274606 |
| Molecular Formula | C11H20N2S |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | N',N'-dimethyl-N-(1-thiophen-3-ylethyl)propane-1,3-diamine |
| SMILES | CC(NCCCN(C)C)c1ccsc1 |
| InChI | InChI=1S/C11H20N2S/c1-10(11-5-8-14-9-11)12-6-4-7-13(2)3/h5,8-10,12H,4,6-7H2,1-3H3 |
| InChIKey | NBQKENLXUXEPOU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|