C14H15Cl2N3OS — CID 47061387
2-(2,5-dichlorophenyl)sulfanyl-N-(2-imidazol-1-ylethyl)propanamide (PubChem CID 47061387) has the molecular formula C14H15Cl2N3OS and a molecular weight of 344.27 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)sulfanyl-N-(2-imidazol-1-ylethyl)propanamide.
| Compound Name | 2-(2,5-dichlorophenyl)sulfanyl-N-(2-imidazol-1-ylethyl)propanamide |
|---|---|
| PubChem CID | 47061387 |
| Molecular Formula | C14H15Cl2N3OS |
| Molecular Weight | 344.27 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 2-(2,5-dichlorophenyl)sulfanyl-N-(2-imidazol-1-ylethyl)propanamide |
| SMILES | CC(Sc1cc(Cl)ccc1Cl)C(=O)NCCn1ccnc1 |
| InChI | InChI=1S/C14H15Cl2N3OS/c1-10(21-13-8-11(15)2-3-12(13)16)14(20)18-5-7-19-6-4-17-9-19/h2-4,6,8-10H,5,7H2,1H3,(H,18,20) |
| InChIKey | BSKVSSQWVSJXLR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.27 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |