C12H18ClN5O2 — CID 114924347
5-chloro-N-[2-(dimethylcarbamoylamino)ethyl]-2-(methylamino)pyridine-4-carboxamide (PubChem CID 114924347) has the molecular formula C12H18ClN5O2 and a molecular weight of 299.76 g/mol. Its IUPAC name is 5-chloro-N-[2-(dimethylcarbamoylamino)ethyl]-2-(methylamino)pyridine-4-carboxamide.
| Compound Name | 5-chloro-N-[2-(dimethylcarbamoylamino)ethyl]-2-(methylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114924347 |
| Molecular Formula | C12H18ClN5O2 |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 5-chloro-N-[2-(dimethylcarbamoylamino)ethyl]-2-(methylamino)pyridine-4-carboxamide |
| SMILES | CNc1cc(C(=O)NCCNC(=O)N(C)C)c(Cl)cn1 |
| InChI | InChI=1S/C12H18ClN5O2/c1-14-10-6-8(9(13)7-17-10)11(19)15-4-5-16-12(20)18(2)3/h6-7H,4-5H2,1-3H3,(H,14,17)(H,15,19)(H,16,20) |
| InChIKey | VZFLMBDAOZGROI-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|