C15H25ClN4O — CID 114922690
5-chloro-N-[1-(dimethylamino)-4-methylpentan-2-yl]-2-(methylamino)pyridine-4-carboxamide (PubChem CID 114922690) has the molecular formula C15H25ClN4O and a molecular weight of 312.85 g/mol. Its IUPAC name is 5-chloro-N-[1-(dimethylamino)-4-methylpentan-2-yl]-2-(methylamino)pyridine-4-carboxamide.
| Compound Name | 5-chloro-N-[1-(dimethylamino)-4-methylpentan-2-yl]-2-(methylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114922690 |
| Molecular Formula | C15H25ClN4O |
| Molecular Weight | 312.85 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 5-chloro-N-[1-(dimethylamino)-4-methylpentan-2-yl]-2-(methylamino)pyridine-4-carboxamide |
| SMILES | CNc1cc(C(=O)NC(CC(C)C)CN(C)C)c(Cl)cn1 |
| InChI | InChI=1S/C15H25ClN4O/c1-10(2)6-11(9-20(4)5)19-15(21)12-7-14(17-3)18-8-13(12)16/h7-8,10-11H,6,9H2,1-5H3,(H,17,18)(H,19,21) |
| InChIKey | BBAJDSULWMIJGN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.85 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |