C13H20ClN3O2 — CID 114923758
5-chloro-N-(1-methoxypentan-2-yl)-2-(methylamino)pyridine-4-carboxamide (PubChem CID 114923758) has the molecular formula C13H20ClN3O2 and a molecular weight of 285.77 g/mol. Its IUPAC name is 5-chloro-N-(1-methoxypentan-2-yl)-2-(methylamino)pyridine-4-carboxamide.
| Compound Name | 5-chloro-N-(1-methoxypentan-2-yl)-2-(methylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114923758 |
| Molecular Formula | C13H20ClN3O2 |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 5-chloro-N-(1-methoxypentan-2-yl)-2-(methylamino)pyridine-4-carboxamide |
| SMILES | CCCC(COC)NC(=O)c1cc(NC)ncc1Cl |
| InChI | InChI=1S/C13H20ClN3O2/c1-4-5-9(8-19-3)17-13(18)10-6-12(15-2)16-7-11(10)14/h6-7,9H,4-5,8H2,1-3H3,(H,15,16)(H,17,18) |
| InChIKey | RJXSJQBMUWOECC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |