C15H20Cl2O2 — CID 43800122
1-(2,5-dichlorophenyl)-2-heptoxyethanone (PubChem CID 43800122) has the molecular formula C15H20Cl2O2 and a molecular weight of 303.23 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-2-heptoxyethanone.
| Compound Name | 1-(2,5-dichlorophenyl)-2-heptoxyethanone |
|---|---|
| PubChem CID | 43800122 |
| Molecular Formula | C15H20Cl2O2 |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-2-heptoxyethanone |
| SMILES | CCCCCCCOCC(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H20Cl2O2/c1-2-3-4-5-6-9-19-11-15(18)13-10-12(16)7-8-14(13)17/h7-8,10H,2-6,9,11H2,1H3 |
| InChIKey | KHPZTGWFQXVLEM-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|