C16H17NO2S — CID 58259864
2-pyridin-2-ylsulfinyl-1-(2,4,6-trimethylphenyl)ethanone (PubChem CID 58259864) has the molecular formula C16H17NO2S and a molecular weight of 287.38 g/mol. Its IUPAC name is 2-pyridin-2-ylsulfinyl-1-(2,4,6-trimethylphenyl)ethanone.
| Compound Name | 2-pyridin-2-ylsulfinyl-1-(2,4,6-trimethylphenyl)ethanone |
|---|---|
| PubChem CID | 58259864 |
| Molecular Formula | C16H17NO2S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 2-pyridin-2-ylsulfinyl-1-(2,4,6-trimethylphenyl)ethanone |
| SMILES | Cc1cc(C)c(C(=O)CS(=O)c2ccccn2)c(C)c1 |
| InChI | InChI=1S/C16H17NO2S/c1-11-8-12(2)16(13(3)9-11)14(18)10-20(19)15-6-4-5-7-17-15/h4-9H,10H2,1-3H3 |
| InChIKey | WRFCJAPIRBXGBW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |