C14H15IN- — CID 156707211
2-(2,4,6-trimethylphenyl)iodanuidylpyridine (PubChem CID 156707211) has the molecular formula C14H15IN- and a molecular weight of 324.19 g/mol. Its IUPAC name is 2-(2,4,6-trimethylphenyl)iodanuidylpyridine.
| Compound Name | 2-(2,4,6-trimethylphenyl)iodanuidylpyridine |
|---|---|
| PubChem CID | 156707211 |
| Molecular Formula | C14H15IN- |
| Molecular Weight | 324.19 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 2-(2,4,6-trimethylphenyl)iodanuidylpyridine |
| SMILES | Cc1cc(C)c([I-]c2ccccn2)c(C)c1 |
| InChI | InChI=1S/C14H15IN/c1-10-8-11(2)14(12(3)9-10)15-13-6-4-5-7-16-13/h4-9H,1-3H3/q-1 |
| InChIKey | WKSULBNSDJJMRX-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.19 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|