C18H19N3 — CID 3651174
6,8-dimethyl-1-pyridin-2-yl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (PubChem CID 3651174) has the molecular formula C18H19N3 and a molecular weight of 277.37 g/mol. Its IUPAC name is 6,8-dimethyl-1-pyridin-2-yl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole.
| Compound Name | 6,8-dimethyl-1-pyridin-2-yl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 3651174 |
| Molecular Formula | C18H19N3 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 6,8-dimethyl-1-pyridin-2-yl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| SMILES | Cc1cc(C)c2[nH]c3c(c2c1)CCNC3c1ccccn1 |
| InChI | InChI=1S/C18H19N3/c1-11-9-12(2)16-14(10-11)13-6-8-20-18(17(13)21-16)15-5-3-4-7-19-15/h3-5,7,9-10,18,20-21H,6,8H2,1-2H3 |
| InChIKey | YIDUKGGSKMBHRV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|