C19H19IN2 — CID 3953952
1-(2-iodophenyl)-5,7-dimethyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (PubChem CID 3953952) has the molecular formula C19H19IN2 and a molecular weight of 402.28 g/mol. Its IUPAC name is 1-(2-iodophenyl)-5,7-dimethyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole.
| Compound Name | 1-(2-iodophenyl)-5,7-dimethyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 3953952 |
| Molecular Formula | C19H19IN2 |
| Molecular Weight | 402.28 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | 1-(2-iodophenyl)-5,7-dimethyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| SMILES | Cc1cc(C)c2c3c([nH]c2c1)C(c1ccccc1I)NCC3 |
| InChI | InChI=1S/C19H19IN2/c1-11-9-12(2)17-14-7-8-21-18(19(14)22-16(17)10-11)13-5-3-4-6-15(13)20/h3-6,9-10,18,21-22H,7-8H2,1-2H3 |
| InChIKey | IOLXHAPHOWZXGM-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.28 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|