C17H21NOS2 — CID 134929663
(1R,2S)-2-methylsulfanyl-2-pyridin-2-ylsulfanyl-1-(2,4,6-trimethylphenyl)ethanol (PubChem CID 134929663) has the molecular formula C17H21NOS2 and a molecular weight of 319.50 g/mol. Its IUPAC name is (1R,2S)-2-methylsulfanyl-2-pyridin-2-ylsulfanyl-1-(2,4,6-trimethylphenyl)ethanol.
| Compound Name | (1R,2S)-2-methylsulfanyl-2-pyridin-2-ylsulfanyl-1-(2,4,6-trimethylphenyl)ethanol |
|---|---|
| PubChem CID | 134929663 |
| Molecular Formula | C17H21NOS2 |
| Molecular Weight | 319.50 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | (1R,2S)-2-methylsulfanyl-2-pyridin-2-ylsulfanyl-1-(2,4,6-trimethylphenyl)ethanol |
| SMILES | CS[C@@H](Sc1ccccn1)[C@H](O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C17H21NOS2/c1-11-9-12(2)15(13(3)10-11)16(19)17(20-4)21-14-7-5-6-8-18-14/h5-10,16-17,19H,1-4H3/t16-,17+/m1/s1 |
| InChIKey | JYTXCDCCDFMVFP-SJORKVTESA-N |
| XLogP | 4.52 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|