C19H25NOS2 — CID 134930064
(1S,2S)-2-propan-2-ylsulfanyl-2-pyridin-2-ylsulfanyl-1-(2,4,6-trimethylphenyl)ethanol (PubChem CID 134930064) has the molecular formula C19H25NOS2 and a molecular weight of 347.55 g/mol. Its IUPAC name is (1S,2S)-2-propan-2-ylsulfanyl-2-pyridin-2-ylsulfanyl-1-(2,4,6-trimethylphenyl)ethanol.
| Compound Name | (1S,2S)-2-propan-2-ylsulfanyl-2-pyridin-2-ylsulfanyl-1-(2,4,6-trimethylphenyl)ethanol |
|---|---|
| PubChem CID | 134930064 |
| Molecular Formula | C19H25NOS2 |
| Molecular Weight | 347.55 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | (1S,2S)-2-propan-2-ylsulfanyl-2-pyridin-2-ylsulfanyl-1-(2,4,6-trimethylphenyl)ethanol |
| SMILES | Cc1cc(C)c([C@H](O)[C@H](Sc2ccccn2)SC(C)C)c(C)c1 |
| InChI | InChI=1S/C19H25NOS2/c1-12(2)22-19(23-16-8-6-7-9-20-16)18(21)17-14(4)10-13(3)11-15(17)5/h6-12,18-19,21H,1-5H3/t18-,19-/m0/s1 |
| InChIKey | PUCOGDQFYKUVHI-OALUTQOASA-N |
| XLogP | 5.30 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.55 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|